C34H63NP2 — CID 57155539
6-dicyclohexylphosphanyl-3-(3-dicyclohexylphosphanylpropyl)-2-methylhex-3-en-2-amine (PubChem CID 57155539) has the molecular formula C34H63NP2 and a molecular weight of 547.83 g/mol. Its IUPAC name is 6-dicyclohexylphosphanyl-3-(3-dicyclohexylphosphanylpropyl)-2-methylhex-3-en-2-amine.
| Compound Name | 6-dicyclohexylphosphanyl-3-(3-dicyclohexylphosphanylpropyl)-2-methylhex-3-en-2-amine |
|---|---|
| PubChem CID | 57155539 |
| Molecular Formula | C34H63NP2 |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.44 |
| IUPAC Name | 6-dicyclohexylphosphanyl-3-(3-dicyclohexylphosphanylpropyl)-2-methylhex-3-en-2-amine |
| SMILES | CC(C)(N)C(=CCCP(C1CCCCC1)C1CCCCC1)CCCP(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C34H63NP2/c1-34(2,35)29(17-15-27-36(30-19-7-3-8-20-30)31-21-9-4-10-22-31)18-16-28-37(32-23-11-5-12-24-32)33-25-13-6-14-26-33/h17,30-33H,3-16,18-28,35H2,1-2H3 |
| InChIKey | BWINGYXUYGKQND-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|