About tert-butyl(dicyclopentyl)phosphane;palladium
tert-butyl(dicyclopentyl)phosphane;palladium (PubChem CID 87489753) has the molecular formula C14H27PPd
and a molecular weight of 332.76 g/mol. Its IUPAC name is tert-butyl(dicyclopentyl)phosphane;palladium.
Molecular Properties
| Compound Name | tert-butyl(dicyclopentyl)phosphane;palladium |
| PubChem CID | 87489753 |
| Molecular Formula | C14H27PPd |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | tert-butyl(dicyclopentyl)phosphane;palladium |
| SMILES | CC(C)(C)P(C1CCCC1)C1CCCC1.[Pd] |
| InChI | InChI=1S/C14H27P.Pd/c1-14(2,3)15(12-8-4-5-9-12)13-10-6-7-11-13;/h12-13H,4-11H2,1-3H3; |
| InChIKey | KJAMUEDGWZQEJP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(dicyclopentyl)phosphane;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(dicyclopentyl)phosphane;palladium?
The IUPAC name of tert-butyl(dicyclopentyl)phosphane;palladium (CID 87489753) is tert-butyl(dicyclopentyl)phosphane;palladium.
What is the SMILES notation for tert-butyl(dicyclopentyl)phosphane;palladium?
The canonical SMILES for tert-butyl(dicyclopentyl)phosphane;palladium is CC(C)(C)P(C1CCCC1)C1CCCC1.[Pd].
What is the InChIKey of tert-butyl(dicyclopentyl)phosphane;palladium?
The InChIKey is KJAMUEDGWZQEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27P.Pd/c1-14(2,3)15(12-8-4-5-9-12)13-10-6-7-11-13;/h12-13H,4-11H2,1-3H3;.
What are the key properties of tert-butyl(dicyclopentyl)phosphane;palladium?
tert-butyl(dicyclopentyl)phosphane;palladium has a molecular weight of 332.76 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(dicyclopentyl)phosphane;palladium is sourced from PubChem (CID 87489753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).