About methyl 5,5-dimethoxypent-2-enoate
methyl 5,5-dimethoxypent-2-enoate (PubChem CID 71373953) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is methyl 5,5-dimethoxypent-2-enoate.
Molecular Properties
| Compound Name | methyl 5,5-dimethoxypent-2-enoate |
| PubChem CID | 71373953 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | methyl 5,5-dimethoxypent-2-enoate |
| SMILES | COC(=O)C=CCC(OC)OC |
| InChI | InChI=1S/C8H14O4/c1-10-7(9)5-4-6-8(11-2)12-3/h4-5,8H,6H2,1-3H3 |
| InChIKey | FFIBISMAOHGYKR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5,5-dimethoxypent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,5-dimethoxypent-2-enoate?
The IUPAC name of methyl 5,5-dimethoxypent-2-enoate (CID 71373953) is methyl 5,5-dimethoxypent-2-enoate.
What is the SMILES notation for methyl 5,5-dimethoxypent-2-enoate?
The canonical SMILES for methyl 5,5-dimethoxypent-2-enoate is COC(=O)C=CCC(OC)OC.
What is the InChIKey of methyl 5,5-dimethoxypent-2-enoate?
The InChIKey is FFIBISMAOHGYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-10-7(9)5-4-6-8(11-2)12-3/h4-5,8H,6H2,1-3H3.
What are the key properties of methyl 5,5-dimethoxypent-2-enoate?
methyl 5,5-dimethoxypent-2-enoate has a molecular weight of 174.20 g/mol, XLogP of 0.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,5-dimethoxypent-2-enoate is sourced from PubChem (CID 71373953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).