C18H36O3 — CID 54274162
1,9,9-tripropoxynon-2-ene (PubChem CID 54274162) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is 1,9,9-tripropoxynon-2-ene.
| Compound Name | 1,9,9-tripropoxynon-2-ene |
|---|---|
| PubChem CID | 54274162 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 1,9,9-tripropoxynon-2-ene |
| SMILES | CCCOCC=CCCCCCC(OCCC)OCCC |
| InChI | InChI=1S/C18H36O3/c1-4-14-19-17-12-10-8-7-9-11-13-18(20-15-5-2)21-16-6-3/h10,12,18H,4-9,11,13-17H2,1-3H3 |
| InChIKey | RMFZQMVYBWXKIS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|