C32H58O3 — CID 142714969
1-methoxy-1-(1-methoxypentadeca-4,9-dienoxy)pentadeca-4,9-diene (PubChem CID 142714969) has the molecular formula C32H58O3 and a molecular weight of 490.81 g/mol. Its IUPAC name is 1-methoxy-1-(1-methoxypentadeca-4,9-dienoxy)pentadeca-4,9-diene.
| Compound Name | 1-methoxy-1-(1-methoxypentadeca-4,9-dienoxy)pentadeca-4,9-diene |
|---|---|
| PubChem CID | 142714969 |
| Molecular Formula | C32H58O3 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 490.44 |
| IUPAC Name | 1-methoxy-1-(1-methoxypentadeca-4,9-dienoxy)pentadeca-4,9-diene |
| SMILES | CCCCCC=CCCCC=CCCC(OC)OC(CCC=CCCCC=CCCCCC)OC |
| InChI | InChI=1S/C32H58O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31(33-3)35-32(34-4)30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,23-26,31-32H,5-12,17-22,27-30H2,1-4H3 |
| InChIKey | AORFAWOMRFBLJK-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|