C10H18O6 — CID 88690128
3-[2-(2-carboxyethoxy)ethoxy]-2,2-dimethylpropanoic acid (PubChem CID 88690128) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-[2-(2-carboxyethoxy)ethoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-(2-carboxyethoxy)ethoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 88690128 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-[2-(2-carboxyethoxy)ethoxy]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(COCCOCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18O6/c1-10(2,9(13)14)7-16-6-5-15-4-3-8(11)12/h3-7H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | ILVRSWNIXOJUEY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|