C20H42N2O6 — CID 171081964
ethane;N-[2-[2-[2-[2-[2-(1-methylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 171081964) has the molecular formula C20H42N2O6 and a molecular weight of 406.56 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-[2-[2-(1-methylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | ethane;N-[2-[2-[2-[2-[2-(1-methylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 171081964 |
| Molecular Formula | C20H42N2O6 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | ethane;N-[2-[2-[2-[2-[2-(1-methylpiperidin-4-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC.CC(=O)NCCOCCOCCOCCOCCOC1CCN(C)CC1 |
| InChI | InChI=1S/C18H36N2O6.C2H6/c1-17(21)19-5-8-22-9-10-23-11-12-24-13-14-25-15-16-26-18-3-6-20(2)7-4-18;1-2/h18H,3-16H2,1-2H3,(H,19,21);1-2H3 |
| InChIKey | WEYHXUFJCSHPHC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|