C17H33N3O6 — CID 177054730
2-[4-[2-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]piperidin-1-yl]-N-methylacetamide (PubChem CID 177054730) has the molecular formula C17H33N3O6 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[2-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 177054730 |
| Molecular Formula | C17H33N3O6 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 2-[4-[2-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(OCCOCC(=O)NCCOCCOC)CC1 |
| InChI | InChI=1S/C17H33N3O6/c1-18-16(21)13-20-6-3-15(4-7-20)26-12-11-25-14-17(22)19-5-8-24-10-9-23-2/h15H,3-14H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | QAXXWWGJFFRSDH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|