C15H32N4O4 — CID 171081625
1-amino-3-[2-[2-[2-(1-propan-2-ylpiperidin-4-yl)oxyethoxy]ethoxy]ethyl]urea (PubChem CID 171081625) has the molecular formula C15H32N4O4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-amino-3-[2-[2-[2-(1-propan-2-ylpiperidin-4-yl)oxyethoxy]ethoxy]ethyl]urea.
| Compound Name | 1-amino-3-[2-[2-[2-(1-propan-2-ylpiperidin-4-yl)oxyethoxy]ethoxy]ethyl]urea |
|---|---|
| PubChem CID | 171081625 |
| Molecular Formula | C15H32N4O4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 1-amino-3-[2-[2-[2-(1-propan-2-ylpiperidin-4-yl)oxyethoxy]ethoxy]ethyl]urea |
| SMILES | CC(C)N1CCC(OCCOCCOCCNC(=O)NN)CC1 |
| InChI | InChI=1S/C15H32N4O4/c1-13(2)19-6-3-14(4-7-19)23-12-11-22-10-9-21-8-5-17-15(20)18-16/h13-14H,3-12,16H2,1-2H3,(H2,17,18,20) |
| InChIKey | CPBHIWLIHUPWAI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|