C24H41N3O4 — CID 89171571
N-[[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]methyl]-2-piperazin-1-ylacetamide (PubChem CID 89171571) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]methyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]methyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 89171571 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | N-[[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]methyl]-2-piperazin-1-ylacetamide |
| SMILES | COC1(OOC2CCC(CNC(=O)CN3CCNCC3)CC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C24H41N3O4/c1-29-24(20-11-18-10-19(13-20)14-21(24)12-18)31-30-22-4-2-17(3-5-22)15-26-23(28)16-27-8-6-25-7-9-27/h17-22,25H,2-16H2,1H3,(H,26,28) |
| InChIKey | YAFWUHQREFTGKX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|