C8H15N3O3 — CID 43162377
methyl N-(2-piperazin-1-ylacetyl)carbamate (PubChem CID 43162377) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is methyl N-(2-piperazin-1-ylacetyl)carbamate.
| Compound Name | methyl N-(2-piperazin-1-ylacetyl)carbamate |
|---|---|
| PubChem CID | 43162377 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | methyl N-(2-piperazin-1-ylacetyl)carbamate |
| SMILES | COC(=O)NC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C8H15N3O3/c1-14-8(13)10-7(12)6-11-4-2-9-3-5-11/h9H,2-6H2,1H3,(H,10,12,13) |
| InChIKey | NWRJQGJVWBDOIA-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |