C22H39N3O2 — CID 46295224
2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 46295224) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 46295224 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | O=C(CC1CCN(C(=O)C2CCCCC2)CC1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C22H39N3O2/c26-21(23-12-7-15-24-13-5-2-6-14-24)18-19-10-16-25(17-11-19)22(27)20-8-3-1-4-9-20/h19-20H,1-18H2,(H,23,26) |
| InChIKey | JSLNZTFVRAVQDG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|