C27H41ClN4O2 — CID 46295293
2-[1-(2-chlorobenzoyl)piperidin-4-yl]-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]acetamide (PubChem CID 46295293) has the molecular formula C27H41ClN4O2 and a molecular weight of 489.10 g/mol. Its IUPAC name is 2-[1-(2-chlorobenzoyl)piperidin-4-yl]-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-[1-(2-chlorobenzoyl)piperidin-4-yl]-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 46295293 |
| Molecular Formula | C27H41ClN4O2 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 2-[1-(2-chlorobenzoyl)piperidin-4-yl]-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2ccccc2Cl)CC1)NCCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C27H41ClN4O2/c28-25-10-5-4-9-24(25)27(34)32-15-11-22(12-16-32)21-26(33)29-13-6-14-30-17-19-31(20-18-30)23-7-2-1-3-8-23/h4-5,9-10,22-23H,1-3,6-8,11-21H2,(H,29,33) |
| InChIKey | YNYOQELYZQPIDP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|