C26H39N3O2 — CID 50768066
2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide (PubChem CID 50768066) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide.
| Compound Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 50768066 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)C2CCCCC2)CC1)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H39N3O2/c30-25(27-14-6-15-28-16-13-22-7-4-5-10-24(22)20-28)19-21-11-17-29(18-12-21)26(31)23-8-2-1-3-9-23/h4-5,7,10,21,23H,1-3,6,8-9,11-20H2,(H,27,30) |
| InChIKey | DXSJQRCLVFJQIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|