C28H33ClN4O2 — CID 50816974
2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide (PubChem CID 50816974) has the molecular formula C28H33ClN4O2 and a molecular weight of 493.05 g/mol. Its IUPAC name is 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide.
| Compound Name | 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 50816974 |
| Molecular Formula | C28H33ClN4O2 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H33ClN4O2/c29-24-6-7-25-23(17-24)18-26(31-25)28(35)33-14-8-20(9-15-33)16-27(34)30-11-3-12-32-13-10-21-4-1-2-5-22(21)19-32/h1-2,4-7,17-18,20,31H,3,8-16,19H2,(H,30,34) |
| InChIKey | GKSMRCHMIAZBGT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|