C25H28ClN3O2 — CID 50816947
2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 50816947) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 50816947 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[1-(5-chloro-1H-indole-2-carbonyl)piperidin-4-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CC1CCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)CC1)NCCCc1ccccc1 |
| InChI | InChI=1S/C25H28ClN3O2/c26-21-8-9-22-20(16-21)17-23(28-22)25(31)29-13-10-19(11-14-29)15-24(30)27-12-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-9,16-17,19,28H,4,7,10-15H2,(H,27,30) |
| InChIKey | LJUQSQRKRBHSAZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|