C22H34N4O — CID 87005803
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 87005803) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 87005803 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O/c27-22(26-16-9-21(10-17-26)25-13-3-4-14-25)23-11-5-12-24-15-8-19-6-1-2-7-20(19)18-24/h1-2,6-7,21H,3-5,8-18H2,(H,23,27) |
| InChIKey | LXFBPEWNZJZZQI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|