C22H31N3O2 — CID 86929747
1-cyclopentyl-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 86929747) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopentyl-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86929747 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-cyclopentyl-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C22H31N3O2/c26-21-14-19(16-25(21)20-8-3-4-9-20)22(27)23-11-5-12-24-13-10-17-6-1-2-7-18(17)15-24/h1-2,6-7,19-20H,3-5,8-16H2,(H,23,27) |
| InChIKey | KVPYAHSNXWJWMR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|