C21H32N4O2 — CID 86831325
N-cyclopentyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylcarbamoylamino]propanamide (PubChem CID 86831325) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-cyclopentyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylcarbamoylamino]propanamide.
| Compound Name | N-cyclopentyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 86831325 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-cyclopentyl-3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propylcarbamoylamino]propanamide |
| SMILES | O=C(CCNC(=O)NCCCN1CCc2ccccc2C1)NC1CCCC1 |
| InChI | InChI=1S/C21H32N4O2/c26-20(24-19-8-3-4-9-19)10-13-23-21(27)22-12-5-14-25-15-11-17-6-1-2-7-18(17)16-25/h1-2,6-7,19H,3-5,8-16H2,(H,24,26)(H2,22,23,27) |
| InChIKey | HZVVHHVXBAEOSI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|