C21H33ClN4O — CID 23609245
1-(3-chloro-2-methylphenyl)-3-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]urea (PubChem CID 23609245) has the molecular formula C21H33ClN4O and a molecular weight of 392.98 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 23609245 |
| Molecular Formula | C21H33ClN4O |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)NCCCN1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C21H33ClN4O/c1-17-19(22)7-5-8-20(17)24-21(27)23-11-6-12-25-15-9-18(10-16-25)26-13-3-2-4-14-26/h5,7-8,18H,2-4,6,9-16H2,1H3,(H2,23,24,27) |
| InChIKey | BENQCSNDSOKANR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|