C20H27N3O2 — CID 97320446
1-[(1S)-cyclohex-2-en-1-yl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]urea (PubChem CID 97320446) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[(1S)-cyclohex-2-en-1-yl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]urea.
| Compound Name | 1-[(1S)-cyclohex-2-en-1-yl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]urea |
|---|---|
| PubChem CID | 97320446 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[(1S)-cyclohex-2-en-1-yl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]urea |
| SMILES | O=C(NCCCC(=O)N1CCc2ccccc2C1)N[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C20H27N3O2/c24-19(23-14-12-16-7-4-5-8-17(16)15-23)11-6-13-21-20(25)22-18-9-2-1-3-10-18/h2,4-5,7-9,18H,1,3,6,10-15H2,(H2,21,22,25)/t18-/m1/s1 |
| InChIKey | RSRUUGZXBCWWBM-GOSISDBHSA-N |
| XLogP | 2.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|