C23H30ClN3O3 — CID 120569046
N-(5-amino-2-methylphenyl)-3,5-dimethyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide;hydrochloride (PubChem CID 120569046) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3,5-dimethyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-3,5-dimethyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120569046 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3,5-dimethyl-4-(2-oxo-2-piperidin-1-ylethoxy)benzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)c1cc(C)c(OCC(=O)N2CCCCC2)c(C)c1.Cl |
| InChI | InChI=1S/C23H29N3O3.ClH/c1-15-7-8-19(24)13-20(15)25-23(28)18-11-16(2)22(17(3)12-18)29-14-21(27)26-9-5-4-6-10-26;/h7-8,11-13H,4-6,9-10,14,24H2,1-3H3,(H,25,28);1H |
| InChIKey | QLDOWKBXYCVEON-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|