C13H15NO5 — CID 7859274
ethyl N-[2-(2-acetylphenoxy)acetyl]carbamate (PubChem CID 7859274) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl N-[2-(2-acetylphenoxy)acetyl]carbamate.
| Compound Name | ethyl N-[2-(2-acetylphenoxy)acetyl]carbamate |
|---|---|
| PubChem CID | 7859274 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl N-[2-(2-acetylphenoxy)acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)COc1ccccc1C(C)=O |
| InChI | InChI=1S/C13H15NO5/c1-3-18-13(17)14-12(16)8-19-11-7-5-4-6-10(11)9(2)15/h4-7H,3,8H2,1-2H3,(H,14,16,17) |
| InChIKey | CXVMKUKIDPQTMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |