C17H20IN2O2+ — CID 2441198
[2-(2-iodoanilino)-2-oxoethyl]-[(1S)-1-(2-methoxyphenyl)ethyl]azanium (PubChem CID 2441198) has the molecular formula C17H20IN2O2+ and a molecular weight of 411.26 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl]-[(1S)-1-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl]-[(1S)-1-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2441198 |
| Molecular Formula | C17H20IN2O2+ |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl]-[(1S)-1-(2-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccccc1[C@H](C)[NH2+]CC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C17H19IN2O2/c1-12(13-7-3-6-10-16(13)22-2)19-11-17(21)20-15-9-5-4-8-14(15)18/h3-10,12,19H,11H2,1-2H3,(H,20,21)/p+1/t12-/m0/s1 |
| InChIKey | ZVHABDXESJHHNY-LBPRGKRZSA-O |
| XLogP | 2.56 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|