C16H18IN2O2+ — CID 2455352
[2-(2-iodoanilino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]azanium (PubChem CID 2455352) has the molecular formula C16H18IN2O2+ and a molecular weight of 397.24 g/mol. Its IUPAC name is [2-(2-iodoanilino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | [2-(2-iodoanilino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2455352 |
| Molecular Formula | C16H18IN2O2+ |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | [2-(2-iodoanilino)-2-oxoethyl]-[(4-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC(=O)Nc2ccccc2I)cc1 |
| InChI | InChI=1S/C16H17IN2O2/c1-21-13-8-6-12(7-9-13)10-18-11-16(20)19-15-5-3-2-4-14(15)17/h2-9,18H,10-11H2,1H3,(H,19,20)/p+1 |
| InChIKey | JFRZKWCQJYUSGF-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|