C18H22N2O4S — CID 18197231
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 18197231) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 18197231 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-ethyl-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCc1noc(C)c1C(=O)OCC(=O)NCCSc1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-4-15-17(13(3)24-20-15)18(22)23-11-16(21)19-9-10-25-14-7-5-12(2)6-8-14/h5-8H,4,9-11H2,1-3H3,(H,19,21) |
| InChIKey | ICYYDHKPHJEMEY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|