C18H21ClN2O4S2 — CID 33000051
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 33000051) has the molecular formula C18H21ClN2O4S2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 33000051 |
| Molecular Formula | C18H21ClN2O4S2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(SCCC(=O)NCCNS(=O)(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21ClN2O4S2/c1-25-15-5-7-16(8-6-15)26-12-9-18(22)20-10-11-21-27(23,24)17-4-2-3-14(19)13-17/h2-8,13,21H,9-12H2,1H3,(H,20,22) |
| InChIKey | LCWUULGREXEQJW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|