C13H22Cl2N4O3S — CID 119389033
N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride (PubChem CID 119389033) has the molecular formula C13H22Cl2N4O3S and a molecular weight of 385.32 g/mol. Its IUPAC name is N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride.
| Compound Name | N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119389033 |
| Molecular Formula | C13H22Cl2N4O3S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCNS(=O)(=O)c1cccnc1)NC1CCNCC1 |
| InChI | InChI=1S/C13H20N4O3S.2ClH/c18-13(17-11-3-7-14-8-4-11)5-9-16-21(19,20)12-2-1-6-15-10-12;;/h1-2,6,10-11,14,16H,3-5,7-9H2,(H,17,18);2*1H |
| InChIKey | CODSLEZOVIHTBW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |