C14H24Cl2N4O3S — CID 119443531
N-methyl-N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride (PubChem CID 119443531) has the molecular formula C14H24Cl2N4O3S and a molecular weight of 399.34 g/mol. Its IUPAC name is N-methyl-N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride.
| Compound Name | N-methyl-N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119443531 |
| Molecular Formula | C14H24Cl2N4O3S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-methyl-N-piperidin-4-yl-3-(pyridin-3-ylsulfonylamino)propanamide;dihydrochloride |
| SMILES | CN(C(=O)CCNS(=O)(=O)c1cccnc1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C14H22N4O3S.2ClH/c1-18(12-4-8-15-9-5-12)14(19)6-10-17-22(20,21)13-3-2-7-16-11-13;;/h2-3,7,11-12,15,17H,4-6,8-10H2,1H3;2*1H |
| InChIKey | DDVGENDKUNHRTF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |