C12H20IN5O2S — CID 110031720
1-cyclopropyl-1-methyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 110031720) has the molecular formula C12H20IN5O2S and a molecular weight of 425.30 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110031720 |
| Molecular Formula | C12H20IN5O2S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCNS(=O)(=O)c1cccnc1)C1CC1.I |
| InChI | InChI=1S/C12H19N5O2S.HI/c1-17(10-4-5-10)12(13)15-7-8-16-20(18,19)11-3-2-6-14-9-11;/h2-3,6,9-10,16H,4-5,7-8H2,1H3,(H2,13,15);1H |
| InChIKey | ISJGNBHXBUCIMH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|