C13H22IN5O2S — CID 136924135
1-ethyl-3-prop-2-enyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide (PubChem CID 136924135) has the molecular formula C13H22IN5O2S and a molecular weight of 439.32 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-enyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-prop-2-enyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136924135 |
| Molecular Formula | C13H22IN5O2S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 1-ethyl-3-prop-2-enyl-2-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N/CCNS(=O)(=O)c1cccnc1)NCC.I |
| InChI | InChI=1S/C13H21N5O2S.HI/c1-3-7-16-13(15-4-2)17-9-10-18-21(19,20)12-6-5-8-14-11-12;/h3,5-6,8,11,18H,1,4,7,9-10H2,2H3,(H2,15,16,17);1H |
| InChIKey | KMOGYNWDVYEQQN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|