C16H27N5O2S2 — CID 109489805
N-ethyl-2,2-dimethyl-N'-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109489805) has the molecular formula C16H27N5O2S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489805 |
| Molecular Formula | C16H27N5O2S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccnc1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H27N5O2S2/c1-4-18-15(21-10-11-24-16(2,3)13-21)19-8-9-20-25(22,23)14-6-5-7-17-12-14/h5-7,12,20H,4,8-11,13H2,1-3H3,(H,18,19) |
| InChIKey | JOGZWHUMUQHGHX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|