C15H25N5O2S2 — CID 109486106
2-ethyl-N'-methyl-N-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 109486106) has the molecular formula C15H25N5O2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486106 |
| Molecular Formula | C15H25N5O2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-(pyridin-3-ylsulfonylamino)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCNS(=O)(=O)c2cccnc2)CCS1 |
| InChI | InChI=1S/C15H25N5O2S2/c1-3-13-12-20(9-10-23-13)15(16-2)18-7-8-19-24(21,22)14-5-4-6-17-11-14/h4-6,11,13,19H,3,7-10,12H2,1-2H3,(H,16,18) |
| InChIKey | HFBILDLCSRQATB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|