C13H23N5S — CID 109485606
2-ethyl-N'-methyl-N-(2-pyrazol-1-ylethyl)thiomorpholine-4-carboximidamide (PubChem CID 109485606) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-(2-pyrazol-1-ylethyl)thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-(2-pyrazol-1-ylethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485606 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-ethyl-N'-methyl-N-(2-pyrazol-1-ylethyl)thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCn2cccn2)CCS1 |
| InChI | InChI=1S/C13H23N5S/c1-3-12-11-17(9-10-19-12)13(14-2)15-6-8-18-7-4-5-16-18/h4-5,7,12H,3,6,8-11H2,1-2H3,(H,14,15) |
| InChIKey | BMZAXAUOENPICU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|