C17H29IN4S — CID 109489184
N-ethyl-2,2-dimethyl-N'-[2-(3-methyl-4-pyridinyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489184) has the molecular formula C17H29IN4S and a molecular weight of 448.42 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N'-[2-(3-methyl-4-pyridinyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2-dimethyl-N'-[2-(3-methyl-4-pyridinyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489184 |
| Molecular Formula | C17H29IN4S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N'-[2-(3-methyl-4-pyridinyl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccncc1C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H28N4S.HI/c1-5-19-16(21-10-11-22-17(3,4)13-21)20-9-7-15-6-8-18-12-14(15)2;/h6,8,12H,5,7,9-11,13H2,1-4H3,(H,19,20);1H |
| InChIKey | PKUIWGCVTSJIHD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|