C18H20N4O4S — CID 43072776
N-[4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]phenyl]cyclopropanecarboxamide (PubChem CID 43072776) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43072776 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[4-[3-(pyridin-3-ylsulfonylamino)propanoylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccnc1)Nc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H20N4O4S/c23-17(9-11-20-27(25,26)16-2-1-10-19-12-16)21-14-5-7-15(8-6-14)22-18(24)13-3-4-13/h1-2,5-8,10,12-13,20H,3-4,9,11H2,(H,21,23)(H,22,24) |
| InChIKey | SHTHDNQSKPSEHD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |