C14H21N3O5S — CID 119357610
4-methyl-4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]pentanoic acid (PubChem CID 119357610) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-methyl-4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119357610 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-methyl-4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]pentanoic acid |
| SMILES | CN(CC(=O)NC(C)(C)CCC(=O)O)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H21N3O5S/c1-14(2,7-6-13(19)20)16-12(18)10-17(3)23(21,22)11-5-4-8-15-9-11/h4-5,8-9H,6-7,10H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | RDFUHCNQVKVZMP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |