C19H19N3O4S — CID 55668935
N-[furan-2-yl(phenyl)methyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide (PubChem CID 55668935) has the molecular formula C19H19N3O4S and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 55668935 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NC(c1ccccc1)c1ccco1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-22(27(24,25)16-9-5-11-20-13-16)14-18(23)21-19(17-10-6-12-26-17)15-7-3-2-4-8-15/h2-13,19H,14H2,1H3,(H,21,23) |
| InChIKey | VQTRJTKAEDJOEN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |