C19H18FN3O3S2 — CID 55666005
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide (PubChem CID 55666005) has the molecular formula C19H18FN3O3S2 and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 55666005 |
| Molecular Formula | C19H18FN3O3S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)NC(c1ccc(F)cc1)c1cccs1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C19H18FN3O3S2/c1-23(28(25,26)16-4-2-10-21-12-16)13-18(24)22-19(17-5-3-11-27-17)14-6-8-15(20)9-7-14/h2-12,19H,13H2,1H3,(H,22,24) |
| InChIKey | ROKBNZWUDGWBHO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |