C13H19N3O5S — CID 119369262
(2R)-3-methyl-2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid (PubChem CID 119369262) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119369262 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2R)-3-methyl-2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CN(C)S(=O)(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C13H19N3O5S/c1-9(2)12(13(18)19)15-11(17)8-16(3)22(20,21)10-5-4-6-14-7-10/h4-7,9,12H,8H2,1-3H3,(H,15,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | SHLCEUUECCBCEG-GFCCVEGCSA-N |
| XLogP | -0.07 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |