C12H20N4O3S — CID 119495672
N-(3-aminobutyl)-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide (PubChem CID 119495672) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide.
| Compound Name | N-(3-aminobutyl)-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 119495672 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-(3-aminobutyl)-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
| SMILES | CC(N)CCNC(=O)CN(C)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C12H20N4O3S/c1-10(13)5-7-15-12(17)9-16(2)20(18,19)11-4-3-6-14-8-11/h3-4,6,8,10H,5,7,9,13H2,1-2H3,(H,15,17) |
| InChIKey | QBUCWAKPBFQTBX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |