C18H21FN4O4S — CID 55666059
3-fluoro-4-methyl-N-[2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]ethyl]benzamide (PubChem CID 55666059) has the molecular formula C18H21FN4O4S and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55666059 |
| Molecular Formula | C18H21FN4O4S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)CN(C)S(=O)(=O)c2cccnc2)cc1F |
| InChI | InChI=1S/C18H21FN4O4S/c1-13-5-6-14(10-16(13)19)18(25)22-9-8-21-17(24)12-23(2)28(26,27)15-4-3-7-20-11-15/h3-7,10-11H,8-9,12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | TVMVUKBVVHDXOY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|