C12H17N3O5S — CID 119352881
4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid (PubChem CID 119352881) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352881 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]amino]butanoic acid |
| SMILES | CN(CC(=O)NCCCC(=O)O)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C12H17N3O5S/c1-15(9-11(16)14-7-3-5-12(17)18)21(19,20)10-4-2-6-13-8-10/h2,4,6,8H,3,5,7,9H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | ANMYFBPXBVKPFX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|