C13H21N3O3S — CID 119429589
2-[benzenesulfonyl(methyl)amino]-N-[3-(methylamino)propyl]acetamide (PubChem CID 119429589) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[benzenesulfonyl(methyl)amino]-N-[3-(methylamino)propyl]acetamide.
| Compound Name | 2-[benzenesulfonyl(methyl)amino]-N-[3-(methylamino)propyl]acetamide |
|---|---|
| PubChem CID | 119429589 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[benzenesulfonyl(methyl)amino]-N-[3-(methylamino)propyl]acetamide |
| SMILES | CNCCCNC(=O)CN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N3O3S/c1-14-9-6-10-15-13(17)11-16(2)20(18,19)12-7-4-3-5-8-12/h3-5,7-8,14H,6,9-11H2,1-2H3,(H,15,17) |
| InChIKey | OWFGWROXMXVNLJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|