C14H24N4O3S — CID 119569250
N-[3-(aminomethyl)pentan-3-yl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide (PubChem CID 119569250) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 119569250 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-2-[methyl(pyridin-3-ylsulfonyl)amino]acetamide |
| SMILES | CCC(CC)(CN)NC(=O)CN(C)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H24N4O3S/c1-4-14(5-2,11-15)17-13(19)10-18(3)22(20,21)12-7-6-8-16-9-12/h6-9H,4-5,10-11,15H2,1-3H3,(H,17,19) |
| InChIKey | SIWZVOZNCILSJD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |