C20H21N3O3S — CID 46435313
2-[methyl(pyridin-3-ylsulfonyl)amino]-N-(1-naphthalen-1-ylethyl)acetamide (PubChem CID 46435313) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[methyl(pyridin-3-ylsulfonyl)amino]-N-(1-naphthalen-1-ylethyl)acetamide.
| Compound Name | 2-[methyl(pyridin-3-ylsulfonyl)amino]-N-(1-naphthalen-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 46435313 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[methyl(pyridin-3-ylsulfonyl)amino]-N-(1-naphthalen-1-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN(C)S(=O)(=O)c1cccnc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H21N3O3S/c1-15(18-11-5-8-16-7-3-4-10-19(16)18)22-20(24)14-23(2)27(25,26)17-9-6-12-21-13-17/h3-13,15H,14H2,1-2H3,(H,22,24) |
| InChIKey | ZWLBAIJFUNFCIF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |