C23H27N3O3S — CID 166187935
2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]-N-(1-naphthalen-1-ylethyl)acetamide (PubChem CID 166187935) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]-N-(1-naphthalen-1-ylethyl)acetamide.
| Compound Name | 2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]-N-(1-naphthalen-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 166187935 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]-N-(1-naphthalen-1-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN(C)C(C)c1cccc(S(N)(=O)=O)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H27N3O3S/c1-16(21-13-7-9-18-8-4-5-12-22(18)21)25-23(27)15-26(3)17(2)19-10-6-11-20(14-19)30(24,28)29/h4-14,16-17H,15H2,1-3H3,(H,25,27)(H2,24,28,29) |
| InChIKey | NGJUTTMXFRGKMH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |