C16H26N4O4S — CID 51135786
N-(tert-butylcarbamoyl)-2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]acetamide (PubChem CID 51135786) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]acetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 51135786 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[methyl-[1-(3-sulfamoylphenyl)ethyl]amino]acetamide |
| SMILES | CC(c1cccc(S(N)(=O)=O)c1)N(C)CC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H26N4O4S/c1-11(12-7-6-8-13(9-12)25(17,23)24)20(5)10-14(21)18-15(22)19-16(2,3)4/h6-9,11H,10H2,1-5H3,(H2,17,23,24)(H2,18,19,21,22) |
| InChIKey | BHUZMULSLRABMC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |