C16H21N5O4S2 — CID 56547085
3-[(4-acetylphenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide (PubChem CID 56547085) has the molecular formula C16H21N5O4S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[(4-acetylphenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide.
| Compound Name | 3-[(4-acetylphenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 56547085 |
| Molecular Formula | C16H21N5O4S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-[(4-acetylphenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCCC(=O)NCCc2n[nH]c(=S)n2C)cc1 |
| InChI | InChI=1S/C16H21N5O4S2/c1-11(22)12-3-5-13(6-4-12)27(24,25)18-10-8-15(23)17-9-7-14-19-20-16(26)21(14)2/h3-6,18H,7-10H2,1-2H3,(H,17,23)(H,20,26) |
| InChIKey | XVJSYOSRANRMHI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|