C10H11ClN4O2S2 — CID 1474049
4-chloro-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide (PubChem CID 1474049) has the molecular formula C10H11ClN4O2S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 4-chloro-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1474049 |
| Molecular Formula | C10H11ClN4O2S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-chloro-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1c(CNS(=O)(=O)c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C10H11ClN4O2S2/c1-15-9(13-14-10(15)18)6-12-19(16,17)8-4-2-7(11)3-5-8/h2-5,12H,6H2,1H3,(H,14,18) |
| InChIKey | JFSHMQFRGIUDOF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|